C11H22N2O5S — CID 122105789
1-[2-methoxyethyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122105789) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-[2-methoxyethyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-methoxyethyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105789 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[2-methoxyethyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | COCCN(C)S(=O)(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C11H22N2O5S/c1-9-6-10(11(14)15)8-13(7-9)19(16,17)12(2)4-5-18-3/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | CTLUOULDADNNON-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |