C13H21N3O5S — CID 122105832
1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122105832) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105832 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | COCCn1cc(S(=O)(=O)N2CC(C)CC(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C13H21N3O5S/c1-10-5-11(13(17)18)8-16(7-10)22(19,20)12-6-14-15(9-12)3-4-21-2/h6,9-11H,3-5,7-8H2,1-2H3,(H,17,18) |
| InChIKey | CNDCBAPEMZMOEM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |