C21H25N3O3 — CID 122106902
1-(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)piperidine-4-carboxylic acid (PubChem CID 122106902) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122106902 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cnn(C3CCCC3)c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3O3/c25-20(23-12-10-16(11-13-23)21(26)27)18-14-22-24(17-8-4-5-9-17)19(18)15-6-2-1-3-7-15/h1-3,6-7,14,16-17H,4-5,8-13H2,(H,26,27) |
| InChIKey | KKFLCBRANZSOOS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |