C23H23N3O3 — CID 122108129
2-[3-[(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)amino]phenyl]acetic acid (PubChem CID 122108129) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[3-[(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 122108129 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[3-[(1-cyclopentyl-5-phenylpyrazole-4-carbonyl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)c2cnn(C3CCCC3)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H23N3O3/c27-21(28)14-16-7-6-10-18(13-16)25-23(29)20-15-24-26(19-11-4-5-12-19)22(20)17-8-2-1-3-9-17/h1-3,6-10,13,15,19H,4-5,11-12,14H2,(H,25,29)(H,27,28) |
| InChIKey | IMNIZWDEIDCSKD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |