About 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid
5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid (PubChem CID 122117013) has the molecular formula C15H21N3O3S
and a molecular weight of 323.42 g/mol. Its IUPAC name is 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid |
| PubChem CID | 122117013 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)C2CCCN2c2nccs2)C1 |
| InChI | InChI=1S/C15H21N3O3S/c1-10-7-11(14(20)21)9-17(8-10)13(19)12-3-2-5-18(12)15-16-4-6-22-15/h4,6,10-12H,2-3,5,7-9H2,1H3,(H,20,21) |
| InChIKey | LSJFTUGLQFGNAB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid?
The IUPAC name of 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid (CID 122117013) is 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid.
What is the SMILES notation for 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid?
The canonical SMILES for 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid is CC1CC(C(=O)O)CN(C(=O)C2CCCN2c2nccs2)C1.
What is the InChIKey of 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid?
The InChIKey is LSJFTUGLQFGNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3S/c1-10-7-11(14(20)21)9-17(8-10)13(19)12-3-2-5-18(12)15-16-4-6-22-15/h4,6,10-12H,2-3,5,7-9H2,1H3,(H,20,21).
What are the key properties of 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid?
5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid has a molecular weight of 323.42 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 122117013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).