C16H23N3O4 — CID 122120620
2-[2-acetamidoethyl-[2-(4-methylanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 122120620) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[2-(4-methylanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[2-(4-methylanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122120620 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[2-acetamidoethyl-[2-(4-methylanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(=O)NCCN(CC(=O)Nc1ccc(C)cc1)C(C)C(=O)O |
| InChI | InChI=1S/C16H23N3O4/c1-11-4-6-14(7-5-11)18-15(21)10-19(12(2)16(22)23)9-8-17-13(3)20/h4-7,12H,8-10H2,1-3H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | JDCJALUAKXRAEL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |