C20H25NO3 — CID 122124270
(2R)-2-[[2-methoxy-5-(2-methylphenyl)phenyl]methylamino]-3-methylbutanoic acid (PubChem CID 122124270) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2R)-2-[[2-methoxy-5-(2-methylphenyl)phenyl]methylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-methoxy-5-(2-methylphenyl)phenyl]methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122124270 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2R)-2-[[2-methoxy-5-(2-methylphenyl)phenyl]methylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc(-c2ccccc2C)cc1CN[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C20H25NO3/c1-13(2)19(20(22)23)21-12-16-11-15(9-10-18(16)24-4)17-8-6-5-7-14(17)3/h5-11,13,19,21H,12H2,1-4H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | AXJSOFSFWICFMA-LJQANCHMSA-N |
| XLogP | 3.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |