C11H19N3O — CID 122125795
2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1-prop-2-enylguanidine (PubChem CID 122125795) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 122125795 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/C[C@@H]1CCO[C@H]1C=C |
| InChI | InChI=1S/C11H19N3O/c1-3-6-13-11(12)14-8-9-5-7-15-10(9)4-2/h3-4,9-10H,1-2,5-8H2,(H3,12,13,14)/t9-,10-/m0/s1 |
| InChIKey | UVMPTXRAENPLFB-UWVGGRQHSA-N |
| XLogP | 0.67 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|