C14H19FIN3 — CID 122126016
1-cyclopropyl-3-(2-fluoro-2-phenylcyclopropyl)-2-methylguanidine;hydroiodide (PubChem CID 122126016) has the molecular formula C14H19FIN3 and a molecular weight of 375.23 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-fluoro-2-phenylcyclopropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-(2-fluoro-2-phenylcyclopropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 122126016 |
| Molecular Formula | C14H19FIN3 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-cyclopropyl-3-(2-fluoro-2-phenylcyclopropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NC1CC1)NC1CC1(F)c1ccccc1.I |
| InChI | InChI=1S/C14H18FN3.HI/c1-16-13(17-11-7-8-11)18-12-9-14(12,15)10-5-3-2-4-6-10;/h2-6,11-12H,7-9H2,1H3,(H2,16,17,18);1H |
| InChIKey | DARCZYSQOODQFW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|