C13H24N4O4 — CID 122126682
2-[[[3-(carbamoylamino)pyrrolidine-1-carbonyl]amino]methyl]-2-ethylbutanoic acid (PubChem CID 122126682) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[[[3-(carbamoylamino)pyrrolidine-1-carbonyl]amino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[[3-(carbamoylamino)pyrrolidine-1-carbonyl]amino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122126682 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[[[3-(carbamoylamino)pyrrolidine-1-carbonyl]amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)N1CCC(NC(N)=O)C1)C(=O)O |
| InChI | InChI=1S/C13H24N4O4/c1-3-13(4-2,10(18)19)8-15-12(21)17-6-5-9(7-17)16-11(14)20/h9H,3-8H2,1-2H3,(H,15,21)(H,18,19)(H3,14,16,20) |
| InChIKey | UUEKZBFXAVNHFX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |