C18H26ClNO3 — CID 122127005
4-[(5-chloro-2-cyclopentyloxyphenyl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127005) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is 4-[(5-chloro-2-cyclopentyloxyphenyl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(5-chloro-2-cyclopentyloxyphenyl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127005 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[(5-chloro-2-cyclopentyloxyphenyl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1cc(Cl)ccc1OC1CCCC1)C(=O)O |
| InChI | InChI=1S/C18H26ClNO3/c1-18(2,17(21)22)9-10-20-12-13-11-14(19)7-8-16(13)23-15-5-3-4-6-15/h7-8,11,15,20H,3-6,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | WRCCRMMUWCPOJY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|