C13H16Cl2FNO2 — CID 122127365
4-[(2,3-dichloro-4-fluorophenyl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127365) has the molecular formula C13H16Cl2FNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is 4-[(2,3-dichloro-4-fluorophenyl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(2,3-dichloro-4-fluorophenyl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127365 |
| Molecular Formula | C13H16Cl2FNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-[(2,3-dichloro-4-fluorophenyl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1ccc(F)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C13H16Cl2FNO2/c1-13(2,12(18)19)5-6-17-7-8-3-4-9(16)11(15)10(8)14/h3-4,17H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | VNZPJLCBOFBCDY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|