C15H22ClNO4S — CID 122127354
4-[(3-chloro-2-ethylsulfonylphenyl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127354) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is 4-[(3-chloro-2-ethylsulfonylphenyl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(3-chloro-2-ethylsulfonylphenyl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127354 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-[(3-chloro-2-ethylsulfonylphenyl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CCS(=O)(=O)c1c(Cl)cccc1CNCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H22ClNO4S/c1-4-22(20,21)13-11(6-5-7-12(13)16)10-17-9-8-15(2,3)14(18)19/h5-7,17H,4,8-10H2,1-3H3,(H,18,19) |
| InChIKey | KTFUYLIPYSTSHV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|