C22H24ClN3O2 — CID 122126819
4-[[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122126819) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 4-[[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122126819 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1cn(-c2ccccc2)nc1-c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C22H24ClN3O2/c1-22(2,21(27)28)11-12-24-14-17-15-26(19-9-4-3-5-10-19)25-20(17)16-7-6-8-18(23)13-16/h3-10,13,15,24H,11-12,14H2,1-2H3,(H,27,28) |
| InChIKey | ADMNHPANWWEEGZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|