C16H19BrN2O2 — CID 122127525
4-[(8-bromoquinolin-4-yl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127525) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 4-[(8-bromoquinolin-4-yl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(8-bromoquinolin-4-yl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127525 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-[(8-bromoquinolin-4-yl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1ccnc2c(Br)cccc12)C(=O)O |
| InChI | InChI=1S/C16H19BrN2O2/c1-16(2,15(20)21)7-9-18-10-11-6-8-19-14-12(11)4-3-5-13(14)17/h3-6,8,18H,7,9-10H2,1-2H3,(H,20,21) |
| InChIKey | CEWSWVISKJQUDJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|