C19H28ClNO3 — CID 126776256
1-(5-chloro-2-cyclopentyloxyphenyl)-N-[(4-methoxyoxan-4-yl)methyl]methanamine (PubChem CID 126776256) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is 1-(5-chloro-2-cyclopentyloxyphenyl)-N-[(4-methoxyoxan-4-yl)methyl]methanamine.
| Compound Name | 1-(5-chloro-2-cyclopentyloxyphenyl)-N-[(4-methoxyoxan-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 126776256 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-(5-chloro-2-cyclopentyloxyphenyl)-N-[(4-methoxyoxan-4-yl)methyl]methanamine |
| SMILES | COC1(CNCc2cc(Cl)ccc2OC2CCCC2)CCOCC1 |
| InChI | InChI=1S/C19H28ClNO3/c1-22-19(8-10-23-11-9-19)14-21-13-15-12-16(20)6-7-18(15)24-17-4-2-3-5-17/h6-7,12,17,21H,2-5,8-11,13-14H2,1H3 |
| InChIKey | JJOICIVKUAYMIV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |