C14H18ClF2NO2 — CID 103991542
1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(1-methoxycyclobutyl)methyl]methanamine (PubChem CID 103991542) has the molecular formula C14H18ClF2NO2 and a molecular weight of 305.75 g/mol. Its IUPAC name is 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(1-methoxycyclobutyl)methyl]methanamine.
| Compound Name | 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(1-methoxycyclobutyl)methyl]methanamine |
|---|---|
| PubChem CID | 103991542 |
| Molecular Formula | C14H18ClF2NO2 |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(1-methoxycyclobutyl)methyl]methanamine |
| SMILES | COC1(CNCc2cc(Cl)ccc2OC(F)F)CCC1 |
| InChI | InChI=1S/C14H18ClF2NO2/c1-19-14(5-2-6-14)9-18-8-10-7-11(15)3-4-12(10)20-13(16)17/h3-4,7,13,18H,2,5-6,8-9H2,1H3 |
| InChIKey | YNFIMEZXRLPGHG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |