C16H25NO3 — CID 122127156
4-[2-(4-methoxyphenyl)propylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127156) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)propylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[2-(4-methoxyphenyl)propylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127156 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)propylamino]-2,2-dimethylbutanoic acid |
| SMILES | COc1ccc(C(C)CNCCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H25NO3/c1-12(13-5-7-14(20-4)8-6-13)11-17-10-9-16(2,3)15(18)19/h5-8,12,17H,9-11H2,1-4H3,(H,18,19) |
| InChIKey | PTLURNJDGYOMNX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|