C18H27ClN2O3 — CID 122128310
2-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122128310) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122128310 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCc1c(Cl)cccc1N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C18H27ClN2O3/c1-3-18(4-2,17(22)23)13-20-12-14-15(19)6-5-7-16(14)21-8-10-24-11-9-21/h5-7,20H,3-4,8-13H2,1-2H3,(H,22,23) |
| InChIKey | DQFOAIJGRKHGLK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |