C19H21ClN2O3 — CID 122036032
4-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]benzoic acid (PubChem CID 122036032) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 4-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122036032 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-[[(2-chloro-6-morpholin-4-ylphenyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCc2c(Cl)cccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H21ClN2O3/c20-17-2-1-3-18(22-8-10-25-11-9-22)16(17)13-21-12-14-4-6-15(7-5-14)19(23)24/h1-7,21H,8-13H2,(H,23,24) |
| InChIKey | SZYLICJFIOJNSK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |