C16H26N2O3S — CID 122133686
1-[1-(3-methoxyphenyl)ethyl]-4-(2-methylsulfonylethyl)piperazine (PubChem CID 122133686) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)ethyl]-4-(2-methylsulfonylethyl)piperazine.
| Compound Name | 1-[1-(3-methoxyphenyl)ethyl]-4-(2-methylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 122133686 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)ethyl]-4-(2-methylsulfonylethyl)piperazine |
| SMILES | COc1cccc(C(C)N2CCN(CCS(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C16H26N2O3S/c1-14(15-5-4-6-16(13-15)21-2)18-9-7-17(8-10-18)11-12-22(3,19)20/h4-6,13-14H,7-12H2,1-3H3 |
| InChIKey | DYUBEHUQVVPEHG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |