C20H24F2N2O3S — CID 133299610
1-[4-(difluoromethylsulfonyl)phenyl]-4-[1-(3-methoxyphenyl)ethyl]piperazine (PubChem CID 133299610) has the molecular formula C20H24F2N2O3S and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-4-[1-(3-methoxyphenyl)ethyl]piperazine.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-4-[1-(3-methoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 133299610 |
| Molecular Formula | C20H24F2N2O3S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-4-[1-(3-methoxyphenyl)ethyl]piperazine |
| SMILES | COc1cccc(C(C)N2CCN(c3ccc(S(=O)(=O)C(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H24F2N2O3S/c1-15(16-4-3-5-18(14-16)27-2)23-10-12-24(13-11-23)17-6-8-19(9-7-17)28(25,26)20(21)22/h3-9,14-15,20H,10-13H2,1-2H3 |
| InChIKey | NZLWGOXAEAEUGF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |