C22H19N3O — CID 122135391
4-(1-cyanocyclopropyl)-N-[(3-cyanophenyl)methyl]-N-prop-2-enylbenzamide (PubChem CID 122135391) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-(1-cyanocyclopropyl)-N-[(3-cyanophenyl)methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-(1-cyanocyclopropyl)-N-[(3-cyanophenyl)methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 122135391 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(1-cyanocyclopropyl)-N-[(3-cyanophenyl)methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cccc(C#N)c1)C(=O)c1ccc(C2(C#N)CC2)cc1 |
| InChI | InChI=1S/C22H19N3O/c1-2-12-25(15-18-5-3-4-17(13-18)14-23)21(26)19-6-8-20(9-7-19)22(16-24)10-11-22/h2-9,13H,1,10-12,15H2 |
| InChIKey | NAGDYOLJADLDDN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|