C18H20N6O — CID 84589469
1-[(3-cyanophenyl)methyl]-3-[2-(dimethylamino)pyrimidin-5-yl]-1-prop-2-enylurea (PubChem CID 84589469) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-3-[2-(dimethylamino)pyrimidin-5-yl]-1-prop-2-enylurea.
| Compound Name | 1-[(3-cyanophenyl)methyl]-3-[2-(dimethylamino)pyrimidin-5-yl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 84589469 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-3-[2-(dimethylamino)pyrimidin-5-yl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccc(C#N)c1)C(=O)Nc1cnc(N(C)C)nc1 |
| InChI | InChI=1S/C18H20N6O/c1-4-8-24(13-15-7-5-6-14(9-15)10-19)18(25)22-16-11-20-17(21-12-16)23(2)3/h4-7,9,11-12H,1,8,13H2,2-3H3,(H,22,25) |
| InChIKey | YPROVZJCXFOBIS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|