C20H18ClN5O — CID 86864338
3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(3-cyanophenyl)methyl]-1-prop-2-enylurea (PubChem CID 86864338) has the molecular formula C20H18ClN5O and a molecular weight of 379.85 g/mol. Its IUPAC name is 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(3-cyanophenyl)methyl]-1-prop-2-enylurea.
| Compound Name | 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(3-cyanophenyl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 86864338 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(3-cyanophenyl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccc(C#N)c1)C(=O)NCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C20H18ClN5O/c1-2-8-25(12-16-5-3-4-15(9-16)10-22)20(27)23-11-18-14-26-13-17(21)6-7-19(26)24-18/h2-7,9,13-14H,1,8,11-12H2,(H,23,27) |
| InChIKey | DPUAIXWOCJYGPE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|