C19H25N3O2 — CID 96565805
1-[(3-cyanophenyl)methyl]-3-[(1R,2R)-2-methoxycyclohexyl]-1-prop-2-enylurea (PubChem CID 96565805) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-3-[(1R,2R)-2-methoxycyclohexyl]-1-prop-2-enylurea.
| Compound Name | 1-[(3-cyanophenyl)methyl]-3-[(1R,2R)-2-methoxycyclohexyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 96565805 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-3-[(1R,2R)-2-methoxycyclohexyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccc(C#N)c1)C(=O)N[C@@H]1CCCC[C@H]1OC |
| InChI | InChI=1S/C19H25N3O2/c1-3-11-22(14-16-8-6-7-15(12-16)13-20)19(23)21-17-9-4-5-10-18(17)24-2/h3,6-8,12,17-18H,1,4-5,9-11,14H2,2H3,(H,21,23)/t17-,18-/m1/s1 |
| InChIKey | AQDIVDZXLJVOIV-QZTJIDSGSA-N |
| XLogP | 3.21 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|