C14H16Cl2N4 — CID 122138465
1-[(2,3-dichlorophenyl)methyl]-3-(1,2,4-triazol-1-yl)piperidine (PubChem CID 122138465) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-3-(1,2,4-triazol-1-yl)piperidine.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-3-(1,2,4-triazol-1-yl)piperidine |
|---|---|
| PubChem CID | 122138465 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-3-(1,2,4-triazol-1-yl)piperidine |
| SMILES | Clc1cccc(CN2CCCC(n3cncn3)C2)c1Cl |
| InChI | InChI=1S/C14H16Cl2N4/c15-13-5-1-3-11(14(13)16)7-19-6-2-4-12(8-19)20-10-17-9-18-20/h1,3,5,9-10,12H,2,4,6-8H2 |
| InChIKey | SAIQAVKZVMZKNJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |