C17H24N4 — CID 129429411
(3R)-1-[(3R)-3-phenylbutyl]-3-(1,2,4-triazol-1-yl)piperidine (PubChem CID 129429411) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is (3R)-1-[(3R)-3-phenylbutyl]-3-(1,2,4-triazol-1-yl)piperidine.
| Compound Name | (3R)-1-[(3R)-3-phenylbutyl]-3-(1,2,4-triazol-1-yl)piperidine |
|---|---|
| PubChem CID | 129429411 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (3R)-1-[(3R)-3-phenylbutyl]-3-(1,2,4-triazol-1-yl)piperidine |
| SMILES | C[C@H](CCN1CCC[C@@H](n2cncn2)C1)c1ccccc1 |
| InChI | InChI=1S/C17H24N4/c1-15(16-6-3-2-4-7-16)9-11-20-10-5-8-17(12-20)21-14-18-13-19-21/h2-4,6-7,13-15,17H,5,8-12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | DCCKAGABDXKKPM-NVXWUHKLSA-N |
| XLogP | 3.11 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |