C18H25N3 — CID 86806813
1-(3-phenylbutyl)-3-(1H-pyrazol-4-yl)piperidine (PubChem CID 86806813) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-(3-phenylbutyl)-3-(1H-pyrazol-4-yl)piperidine.
| Compound Name | 1-(3-phenylbutyl)-3-(1H-pyrazol-4-yl)piperidine |
|---|---|
| PubChem CID | 86806813 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 1-(3-phenylbutyl)-3-(1H-pyrazol-4-yl)piperidine |
| SMILES | CC(CCN1CCCC(c2cn[nH]c2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H25N3/c1-15(16-6-3-2-4-7-16)9-11-21-10-5-8-17(14-21)18-12-19-20-13-18/h2-4,6-7,12-13,15,17H,5,8-11,14H2,1H3,(H,19,20) |
| InChIKey | SSIIDAABHMNGBG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |