C17H22ClN3O2 — CID 86771121
1-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)piperidine (PubChem CID 86771121) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 1-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)piperidine.
| Compound Name | 1-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)piperidine |
|---|---|
| PubChem CID | 86771121 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)piperidine |
| SMILES | COc1ccc(CN2CCCC(c3cn[nH]c3)C2)c(Cl)c1OC |
| InChI | InChI=1S/C17H22ClN3O2/c1-22-15-6-5-13(16(18)17(15)23-2)11-21-7-3-4-12(10-21)14-8-19-20-9-14/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,19,20) |
| InChIKey | OHNQHKZXXJFFGU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |