C16H20N4O4 — CID 97158530
2-methoxy-6-nitro-4-[[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]methyl]phenol (PubChem CID 97158530) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-6-nitro-4-[[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 97158530 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-methoxy-6-nitro-4-[[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]methyl]phenol |
| SMILES | COc1cc(CN2CCC[C@@H](c3cn[nH]c3)C2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H20N4O4/c1-24-15-6-11(5-14(16(15)21)20(22)23)9-19-4-2-3-12(10-19)13-7-17-18-8-13/h5-8,12,21H,2-4,9-10H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | OOYOTZSIHCVIPV-GFCCVEGCSA-N |
| XLogP | 2.41 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|