C17H28N6O2 — CID 122139210
N-ethyl-N-methyl-2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]carbamoylamino]propanamide (PubChem CID 122139210) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]carbamoylamino]propanamide.
| Compound Name | N-ethyl-N-methyl-2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 122139210 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-ethyl-N-methyl-2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]carbamoylamino]propanamide |
| SMILES | CCN(C)C(=O)C(C)NC(=O)NC1CCCN(c2ccc(C)nn2)C1 |
| InChI | InChI=1S/C17H28N6O2/c1-5-22(4)16(24)13(3)18-17(25)19-14-7-6-10-23(11-14)15-9-8-12(2)20-21-15/h8-9,13-14H,5-7,10-11H2,1-4H3,(H2,18,19,25) |
| InChIKey | CVSQSVPDRYSGOK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |