C14H24N4O3S — CID 124887107
(2R)-2-methoxy-N-[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]propane-1-sulfonamide (PubChem CID 124887107) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]propane-1-sulfonamide.
| Compound Name | (2R)-2-methoxy-N-[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 124887107 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-2-methoxy-N-[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]propane-1-sulfonamide |
| SMILES | CO[C@H](C)CS(=O)(=O)N[C@@H]1CCCN(c2ccc(C)nn2)C1 |
| InChI | InChI=1S/C14H24N4O3S/c1-11-6-7-14(16-15-11)18-8-4-5-13(9-18)17-22(19,20)10-12(2)21-3/h6-7,12-13,17H,4-5,8-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | AWRDUDAVZLIVCE-CHWSQXEVSA-N |
| XLogP | 0.71 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |