C17H18N4O3 — CID 122143050
2-(2,4-dioxo-1,3-diazinan-1-yl)-N-(2-ethylquinolin-4-yl)acetamide (PubChem CID 122143050) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-N-(2-ethylquinolin-4-yl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-N-(2-ethylquinolin-4-yl)acetamide |
|---|---|
| PubChem CID | 122143050 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-N-(2-ethylquinolin-4-yl)acetamide |
| SMILES | CCc1cc(NC(=O)CN2CCC(=O)NC2=O)c2ccccc2n1 |
| InChI | InChI=1S/C17H18N4O3/c1-2-11-9-14(12-5-3-4-6-13(12)18-11)19-16(23)10-21-8-7-15(22)20-17(21)24/h3-6,9H,2,7-8,10H2,1H3,(H,18,19,23)(H,20,22,24) |
| InChIKey | HPIGHQGIWJFBKZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |