C17H20N2O3S — CID 75521076
2-(1,1-dioxothiolan-3-yl)-N-(2-ethylquinolin-4-yl)acetamide (PubChem CID 75521076) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(2-ethylquinolin-4-yl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(2-ethylquinolin-4-yl)acetamide |
|---|---|
| PubChem CID | 75521076 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(2-ethylquinolin-4-yl)acetamide |
| SMILES | CCc1cc(NC(=O)CC2CCS(=O)(=O)C2)c2ccccc2n1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-13-10-16(14-5-3-4-6-15(14)18-13)19-17(20)9-12-7-8-23(21,22)11-12/h3-6,10,12H,2,7-9,11H2,1H3,(H,18,19,20) |
| InChIKey | JTMAKFDXDNVUOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |