C16H21N3O3S — CID 78814283
2-(1,1-dioxothiolan-3-yl)-N-(1-propylbenzimidazol-2-yl)acetamide (PubChem CID 78814283) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(1-propylbenzimidazol-2-yl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(1-propylbenzimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 78814283 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(1-propylbenzimidazol-2-yl)acetamide |
| SMILES | CCCn1c(NC(=O)CC2CCS(=O)(=O)C2)nc2ccccc21 |
| InChI | InChI=1S/C16H21N3O3S/c1-2-8-19-14-6-4-3-5-13(14)17-16(19)18-15(20)10-12-7-9-23(21,22)11-12/h3-6,12H,2,7-11H2,1H3,(H,17,18,20) |
| InChIKey | FFAWDPXNGGOCFM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |