C15H17N3O5 — CID 122145656
N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)-3-methyl-4-nitrobenzamide (PubChem CID 122145656) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)-3-methyl-4-nitrobenzamide.
| Compound Name | N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 122145656 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NC2CC(=O)N(C(C)C)C2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O5/c1-8(2)17-13(19)7-11(15(17)21)16-14(20)10-4-5-12(18(22)23)9(3)6-10/h4-6,8,11H,7H2,1-3H3,(H,16,20) |
| InChIKey | MXQSTGNTVVJZJC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|