C13H12Cl3N3O2 — CID 122148460
2-(1H-pyrazol-5-yl)-N-[2-(2,4,6-trichlorophenoxy)ethyl]acetamide (PubChem CID 122148460) has the molecular formula C13H12Cl3N3O2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)-N-[2-(2,4,6-trichlorophenoxy)ethyl]acetamide.
| Compound Name | 2-(1H-pyrazol-5-yl)-N-[2-(2,4,6-trichlorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 122148460 |
| Molecular Formula | C13H12Cl3N3O2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)-N-[2-(2,4,6-trichlorophenoxy)ethyl]acetamide |
| SMILES | O=C(Cc1ccn[nH]1)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl3N3O2/c14-8-5-10(15)13(11(16)6-8)21-4-3-17-12(20)7-9-1-2-18-19-9/h1-2,5-6H,3-4,7H2,(H,17,20)(H,18,19) |
| InChIKey | DOUMDSFIVBEBIJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|