C17H16N2O3 — CID 122149826
2,3-dihydroxy-N-(1H-indol-4-ylmethyl)-N-methylbenzamide (PubChem CID 122149826) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(1H-indol-4-ylmethyl)-N-methylbenzamide.
| Compound Name | 2,3-dihydroxy-N-(1H-indol-4-ylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 122149826 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2,3-dihydroxy-N-(1H-indol-4-ylmethyl)-N-methylbenzamide |
| SMILES | CN(Cc1cccc2[nH]ccc12)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C17H16N2O3/c1-19(17(22)13-5-3-7-15(20)16(13)21)10-11-4-2-6-14-12(11)8-9-18-14/h2-9,18,20-21H,10H2,1H3 |
| InChIKey | CHNPTSYKLVLRCX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|