C16H20N2O3S — CID 136536055
2-(1,1-dioxothiolan-3-yl)-N-(1H-indol-4-ylmethyl)-N-methylacetamide (PubChem CID 136536055) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(1H-indol-4-ylmethyl)-N-methylacetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(1H-indol-4-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 136536055 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(1H-indol-4-ylmethyl)-N-methylacetamide |
| SMILES | CN(Cc1cccc2[nH]ccc12)C(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20N2O3S/c1-18(16(19)9-12-6-8-22(20,21)11-12)10-13-3-2-4-15-14(13)5-7-17-15/h2-5,7,12,17H,6,8-11H2,1H3 |
| InChIKey | LTMKDABIRLRXGD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |