C11H13N3OS — CID 122150073
3-(2-ethylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-one (PubChem CID 122150073) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-(2-ethylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 122150073 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCSCCn1cnc2cnccc2c1=O |
| InChI | InChI=1S/C11H13N3OS/c1-2-16-6-5-14-8-13-10-7-12-4-3-9(10)11(14)15/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | NXMSJQVZBVOLFB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|