C13H15F3N2 — CID 122150496
2-[2-(4-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetonitrile (PubChem CID 122150496) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetonitrile.
| Compound Name | 2-[2-(4-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 122150496 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[2-(4-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetonitrile |
| SMILES | Cc1ccc(CCN(CC#N)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2/c1-11-2-4-12(5-3-11)6-8-18(9-7-17)10-13(14,15)16/h2-5H,6,8-10H2,1H3 |
| InChIKey | GABYVZSMTFQKES-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|