C16H20N4O3S — CID 122150516
methyl 2-[3-[[(1S)-1-(2-methylsulfanylphenyl)ethyl]carbamoylamino]pyrazol-1-yl]acetate (PubChem CID 122150516) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is methyl 2-[3-[[(1S)-1-(2-methylsulfanylphenyl)ethyl]carbamoylamino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[(1S)-1-(2-methylsulfanylphenyl)ethyl]carbamoylamino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 122150516 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 2-[3-[[(1S)-1-(2-methylsulfanylphenyl)ethyl]carbamoylamino]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1ccc(NC(=O)N[C@@H](C)c2ccccc2SC)n1 |
| InChI | InChI=1S/C16H20N4O3S/c1-11(12-6-4-5-7-13(12)24-3)17-16(22)18-14-8-9-20(19-14)10-15(21)23-2/h4-9,11H,10H2,1-3H3,(H2,17,18,19,22)/t11-/m0/s1 |
| InChIKey | VRUONHHBQJGBHZ-NSHDSACASA-N |
| XLogP | 2.66 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |