C20H23N5O2 — CID 166231337
1-(3-phenoxybutan-2-yl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea (PubChem CID 166231337) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-(3-phenoxybutan-2-yl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea.
| Compound Name | 1-(3-phenoxybutan-2-yl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 166231337 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-(3-phenoxybutan-2-yl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea |
| SMILES | CC(NC(=O)Nc1ccn(Cc2ccncc2)n1)C(C)Oc1ccccc1 |
| InChI | InChI=1S/C20H23N5O2/c1-15(16(2)27-18-6-4-3-5-7-18)22-20(26)23-19-10-13-25(24-19)14-17-8-11-21-12-9-17/h3-13,15-16H,14H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | DDMPFPMDAGSTDZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |