C15H19N3O4S2 — CID 122150658
1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide (PubChem CID 122150658) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide.
| Compound Name | 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 122150658 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide |
| SMILES | CC(C)CNS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccccn1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-12(2)11-17-23(19,20)13-7-3-4-8-14(13)24(21,22)18-15-9-5-6-10-16-15/h3-10,12,17H,11H2,1-2H3,(H,16,18) |
| InChIKey | MYNNMPVVFCLJDX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |