About 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide
1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide (PubChem CID 122150658) has the molecular formula C15H19N3O4S2
and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide.
Molecular Properties
| Compound Name | 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide |
| PubChem CID | 122150658 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide |
| SMILES | CC(C)CNS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccccn1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-12(2)11-17-23(19,20)13-7-3-4-8-14(13)24(21,22)18-15-9-5-6-10-16-15/h3-10,12,17H,11H2,1-2H3,(H,16,18) |
| InChIKey | MYNNMPVVFCLJDX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide?
The IUPAC name of 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide (CID 122150658) is 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide.
What is the SMILES notation for 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide?
The canonical SMILES for 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide is CC(C)CNS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccccn1.
What is the InChIKey of 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide?
The InChIKey is MYNNMPVVFCLJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4S2/c1-12(2)11-17-23(19,20)13-7-3-4-8-14(13)24(21,22)18-15-9-5-6-10-16-15/h3-10,12,17H,11H2,1-2H3,(H,16,18).
What are the key properties of 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide?
1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide has a molecular weight of 369.47 g/mol, XLogP of 1.82, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(2-methylpropyl)-2-N-pyridin-2-ylbenzene-1,2-disulfonamide is sourced from PubChem (CID 122150658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).