C13H16N4O5S — CID 122151026
N-[5-(3-methylbutyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 122151026) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[5-(3-methylbutyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[5-(3-methylbutyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122151026 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[5-(3-methylbutyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | CC(C)CCc1nnc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C13H16N4O5S/c1-9(2)3-8-12-14-15-13(22-12)16-23(20,21)11-6-4-10(5-7-11)17(18)19/h4-7,9H,3,8H2,1-2H3,(H,15,16) |
| InChIKey | ZJHQGCFXUXVCSY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|