C11H12FN3O5S2 — CID 126819592
3-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 126819592) has the molecular formula C11H12FN3O5S2 and a molecular weight of 349.37 g/mol. Its IUPAC name is 3-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 126819592 |
| Molecular Formula | C11H12FN3O5S2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 3-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CCCc1nnc(NS(=O)(=O)c2cccc(S(=O)(=O)F)c2)o1 |
| InChI | InChI=1S/C11H12FN3O5S2/c1-2-4-10-13-14-11(20-10)15-22(18,19)9-6-3-5-8(7-9)21(12,16)17/h3,5-7H,2,4H2,1H3,(H,14,15) |
| InChIKey | GYPKWVGYFAXDCU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |