C16H24N2O5 — CID 122151959
tert-butyl N-[2-(oxan-3-ylmethylcarbamoyl)furan-3-yl]carbamate (PubChem CID 122151959) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl N-[2-(oxan-3-ylmethylcarbamoyl)furan-3-yl]carbamate.
| Compound Name | tert-butyl N-[2-(oxan-3-ylmethylcarbamoyl)furan-3-yl]carbamate |
|---|---|
| PubChem CID | 122151959 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl N-[2-(oxan-3-ylmethylcarbamoyl)furan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccoc1C(=O)NCC1CCCOC1 |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(20)18-12-6-8-22-13(12)14(19)17-9-11-5-4-7-21-10-11/h6,8,11H,4-5,7,9-10H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | MENLRLVKCYYUOL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |