C18H23NO4S — CID 122152034
(E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 122152034) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122152034 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CCCC3(CCS(=O)(=O)C3)C2)c1 |
| InChI | InChI=1S/C18H23NO4S/c1-23-16-5-2-4-15(12-16)6-7-17(20)19-10-3-8-18(13-19)9-11-24(21,22)14-18/h2,4-7,12H,3,8-11,13-14H2,1H3/b7-6+ |
| InChIKey | LAQSLYGKNOKYLZ-VOTSOKGWSA-N |
| XLogP | 2.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|