About (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one
(E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 122152034) has the molecular formula C18H23NO4S
and a molecular weight of 349.45 g/mol. Its IUPAC name is (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| PubChem CID | 122152034 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CCCC3(CCS(=O)(=O)C3)C2)c1 |
| InChI | InChI=1S/C18H23NO4S/c1-23-16-5-2-4-15(12-16)6-7-17(20)19-10-3-8-18(13-19)9-11-24(21,22)14-18/h2,4-7,12H,3,8-11,13-14H2,1H3/b7-6+ |
| InChIKey | LAQSLYGKNOKYLZ-VOTSOKGWSA-N |
| XLogP | 2.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
The IUPAC name of (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one (CID 122152034) is (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one is COc1cccc(/C=C/C(=O)N2CCCC3(CCS(=O)(=O)C3)C2)c1.
What is the InChIKey of (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
The InChIKey is LAQSLYGKNOKYLZ-VOTSOKGWSA-N. The full InChI is InChI=1S/C18H23NO4S/c1-23-16-5-2-4-15(12-16)6-7-17(20)19-10-3-8-18(13-19)9-11-24(21,22)14-18/h2,4-7,12H,3,8-11,13-14H2,1H3/b7-6+.
What are the key properties of (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
(E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one has a molecular weight of 349.45 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)-3-(3-methoxyphenyl)prop-2-en-1-one is sourced from PubChem (CID 122152034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).