C11H11FIN3O — CID 122156366
N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-fluoro-2-iodoaniline (PubChem CID 122156366) has the molecular formula C11H11FIN3O and a molecular weight of 347.13 g/mol. Its IUPAC name is N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-fluoro-2-iodoaniline.
| Compound Name | N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 122156366 |
| Molecular Formula | C11H11FIN3O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-fluoro-2-iodoaniline |
| SMILES | CCc1nnc(CNc2cccc(F)c2I)o1 |
| InChI | InChI=1S/C11H11FIN3O/c1-2-9-15-16-10(17-9)6-14-8-5-3-4-7(12)11(8)13/h3-5,14H,2,6H2,1H3 |
| InChIKey | LGJWHIAWUPLIJP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|